C11H5F15O2 — CID 134919125
ethyl (E)-2,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluoronon-2-enoate (PubChem CID 134919125) has the molecular formula C11H5F15O2 and a molecular weight of 454.13 g/mol. Its IUPAC name is ethyl (E)-2,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluoronon-2-enoate.
| Compound Name | ethyl (E)-2,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluoronon-2-enoate |
|---|---|
| PubChem CID | 134919125 |
| Molecular Formula | C11H5F15O2 |
| Molecular Weight | 454.13 g/mol |
| Exact Mass | 454.01 |
| IUPAC Name | ethyl (E)-2,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluoronon-2-enoate |
| SMILES | CCOC(=O)/C(F)=C(\F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H5F15O2/c1-2-28-5(27)3(12)4(13)6(14,15)7(16,17)8(18,19)9(20,21)10(22,23)11(24,25)26/h2H2,1H3/b4-3+ |
| InChIKey | YHQBKDLBTAUZOB-ONEGZZNKSA-N |
| XLogP | 5.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.13 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|