C27H48O3Si3 — CID 134919163
methyl (1R,1aR,6S,6aR,6bS)-5-oxo-1,6-bis(trimethylsilyl)-4-tri(propan-2-yl)silyl-1,6,6a,6b-tetrahydrocyclopropa[e]indene-1a-carboxylate (PubChem CID 134919163) has the molecular formula C27H48O3Si3 and a molecular weight of 504.94 g/mol. Its IUPAC name is methyl (1R,1aR,6S,6aR,6bS)-5-oxo-1,6-bis(trimethylsilyl)-4-tri(propan-2-yl)silyl-1,6,6a,6b-tetrahydrocyclopropa[e]indene-1a-carboxylate.
| Compound Name | methyl (1R,1aR,6S,6aR,6bS)-5-oxo-1,6-bis(trimethylsilyl)-4-tri(propan-2-yl)silyl-1,6,6a,6b-tetrahydrocyclopropa[e]indene-1a-carboxylate |
|---|---|
| PubChem CID | 134919163 |
| Molecular Formula | C27H48O3Si3 |
| Molecular Weight | 504.94 g/mol |
| Exact Mass | 504.29 |
| IUPAC Name | methyl (1R,1aR,6S,6aR,6bS)-5-oxo-1,6-bis(trimethylsilyl)-4-tri(propan-2-yl)silyl-1,6,6a,6b-tetrahydrocyclopropa[e]indene-1a-carboxylate |
| SMILES | COC(=O)[C@@]12C=CC3=C([Si](C(C)C)(C(C)C)C(C)C)C(=O)[C@@H]([Si](C)(C)C)[C@@H]3[C@@H]1[C@H]2[Si](C)(C)C |
| InChI | InChI=1S/C27H48O3Si3/c1-16(2)33(17(3)4,18(5)6)23-19-14-15-27(26(29)30-7)21(25(27)32(11,12)13)20(19)24(22(23)28)31(8,9)10/h14-18,20-21,24-25H,1-13H3/t20-,21+,24-,25+,27-/m0/s1 |
| InChIKey | CPTNYPBBPIWSOP-ITMLTHPUSA-N |
| XLogP | 7.48 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.94 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|