C19H19Cl4N5O2 — CID 134919173
1,3-bis(2,5-dichlorophenyl)-5,6-bis(dimethylamino)-1,3,5-triazinane-2,4-dione (PubChem CID 134919173) has the molecular formula C19H19Cl4N5O2 and a molecular weight of 491.21 g/mol. Its IUPAC name is 1,3-bis(2,5-dichlorophenyl)-5,6-bis(dimethylamino)-1,3,5-triazinane-2,4-dione.
| Compound Name | 1,3-bis(2,5-dichlorophenyl)-5,6-bis(dimethylamino)-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 134919173 |
| Molecular Formula | C19H19Cl4N5O2 |
| Molecular Weight | 491.21 g/mol |
| Exact Mass | 489.03 |
| IUPAC Name | 1,3-bis(2,5-dichlorophenyl)-5,6-bis(dimethylamino)-1,3,5-triazinane-2,4-dione |
| SMILES | CN(C)C1N(c2cc(Cl)ccc2Cl)C(=O)N(c2cc(Cl)ccc2Cl)C(=O)N1N(C)C |
| InChI | InChI=1S/C19H19Cl4N5O2/c1-24(2)17-26(15-9-11(20)5-7-13(15)22)18(29)27(19(30)28(17)25(3)4)16-10-12(21)6-8-14(16)23/h5-10,17H,1-4H3 |
| InChIKey | UOQQFTCNXBXXOS-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 50.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.21 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |