About (4R,5R)-5-methoxy-3,4-dimethyl-2-tri(propan-2-yl)silylcyclopent-2-en-1-one
(4R,5R)-5-methoxy-3,4-dimethyl-2-tri(propan-2-yl)silylcyclopent-2-en-1-one (PubChem CID 134919192) has the molecular formula C17H32O2Si
and a molecular weight of 296.53 g/mol. Its IUPAC name is (4R,5R)-5-methoxy-3,4-dimethyl-2-tri(propan-2-yl)silylcyclopent-2-en-1-one.
Molecular Properties
| Compound Name | (4R,5R)-5-methoxy-3,4-dimethyl-2-tri(propan-2-yl)silylcyclopent-2-en-1-one |
| PubChem CID | 134919192 |
| Molecular Formula | C17H32O2Si |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | (4R,5R)-5-methoxy-3,4-dimethyl-2-tri(propan-2-yl)silylcyclopent-2-en-1-one |
| SMILES | CO[C@H]1C(=O)C([Si](C(C)C)(C(C)C)C(C)C)=C(C)[C@H]1C |
| InChI | InChI=1S/C17H32O2Si/c1-10(2)20(11(3)4,12(5)6)17-14(8)13(7)16(19-9)15(17)18/h10-13,16H,1-9H3/t13-,16-/m1/s1 |
| InChIKey | HMLYDVFCSSANLG-CZUORRHYSA-N |
| XLogP | 4.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4R,5R)-5-methoxy-3,4-dimethyl-2-tri(propan-2-yl)silylcyclopent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,5R)-5-methoxy-3,4-dimethyl-2-tri(propan-2-yl)silylcyclopent-2-en-1-one?
The IUPAC name of (4R,5R)-5-methoxy-3,4-dimethyl-2-tri(propan-2-yl)silylcyclopent-2-en-1-one (CID 134919192) is (4R,5R)-5-methoxy-3,4-dimethyl-2-tri(propan-2-yl)silylcyclopent-2-en-1-one.
What is the SMILES notation for (4R,5R)-5-methoxy-3,4-dimethyl-2-tri(propan-2-yl)silylcyclopent-2-en-1-one?
The canonical SMILES for (4R,5R)-5-methoxy-3,4-dimethyl-2-tri(propan-2-yl)silylcyclopent-2-en-1-one is CO[C@H]1C(=O)C([Si](C(C)C)(C(C)C)C(C)C)=C(C)[C@H]1C.
What is the InChIKey of (4R,5R)-5-methoxy-3,4-dimethyl-2-tri(propan-2-yl)silylcyclopent-2-en-1-one?
The InChIKey is HMLYDVFCSSANLG-CZUORRHYSA-N. The full InChI is InChI=1S/C17H32O2Si/c1-10(2)20(11(3)4,12(5)6)17-14(8)13(7)16(19-9)15(17)18/h10-13,16H,1-9H3/t13-,16-/m1/s1.
What are the key properties of (4R,5R)-5-methoxy-3,4-dimethyl-2-tri(propan-2-yl)silylcyclopent-2-en-1-one?
(4R,5R)-5-methoxy-3,4-dimethyl-2-tri(propan-2-yl)silylcyclopent-2-en-1-one has a molecular weight of 296.53 g/mol, XLogP of 4.75, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5R)-5-methoxy-3,4-dimethyl-2-tri(propan-2-yl)silylcyclopent-2-en-1-one is sourced from PubChem (CID 134919192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).