C23H19F12N5O2 — CID 134919445
1,3-bis[3,5-bis(trifluoromethyl)phenyl]-5,6-bis(dimethylamino)-1,3,5-triazinane-2,4-dione (PubChem CID 134919445) has the molecular formula C23H19F12N5O2 and a molecular weight of 625.41 g/mol. Its IUPAC name is 1,3-bis[3,5-bis(trifluoromethyl)phenyl]-5,6-bis(dimethylamino)-1,3,5-triazinane-2,4-dione.
| Compound Name | 1,3-bis[3,5-bis(trifluoromethyl)phenyl]-5,6-bis(dimethylamino)-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 134919445 |
| Molecular Formula | C23H19F12N5O2 |
| Molecular Weight | 625.41 g/mol |
| Exact Mass | 625.13 |
| IUPAC Name | 1,3-bis[3,5-bis(trifluoromethyl)phenyl]-5,6-bis(dimethylamino)-1,3,5-triazinane-2,4-dione |
| SMILES | CN(C)C1N(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)C(=O)N(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)C(=O)N1N(C)C |
| InChI | InChI=1S/C23H19F12N5O2/c1-36(2)17-38(15-7-11(20(24,25)26)5-12(8-15)21(27,28)29)18(41)39(19(42)40(17)37(3)4)16-9-13(22(30,31)32)6-14(10-16)23(33,34)35/h5-10,17H,1-4H3 |
| InChIKey | QLMZERXXHMANGD-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 50.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.41 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |