C12H16O4 — CID 134919519
(1'S,5S,6'R)-2,2-dimethylspiro[1,3-dioxolane-5,8'-bicyclo[4.2.0]octane]-4,7'-dione (PubChem CID 134919519) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is (1'S,5S,6'R)-2,2-dimethylspiro[1,3-dioxolane-5,8'-bicyclo[4.2.0]octane]-4,7'-dione.
| Compound Name | (1'S,5S,6'R)-2,2-dimethylspiro[1,3-dioxolane-5,8'-bicyclo[4.2.0]octane]-4,7'-dione |
|---|---|
| PubChem CID | 134919519 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (1'S,5S,6'R)-2,2-dimethylspiro[1,3-dioxolane-5,8'-bicyclo[4.2.0]octane]-4,7'-dione |
| SMILES | CC1(C)OC(=O)[C@@]2(O1)C(=O)[C@@H]1CCCC[C@@H]12 |
| InChI | InChI=1S/C12H16O4/c1-11(2)15-10(14)12(16-11)8-6-4-3-5-7(8)9(12)13/h7-8H,3-6H2,1-2H3/t7-,8+,12+/m1/s1 |
| InChIKey | RBCMPIKMYFAJCK-LWINAJNOSA-N |
| XLogP | 1.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|