C18H19NOS — CID 134919527
(3S,4R)-1-ethyl-3-methyl-4-phenyl-3-phenylsulfanylazetidin-2-one (PubChem CID 134919527) has the molecular formula C18H19NOS and a molecular weight of 297.42 g/mol. Its IUPAC name is (3S,4R)-1-ethyl-3-methyl-4-phenyl-3-phenylsulfanylazetidin-2-one.
| Compound Name | (3S,4R)-1-ethyl-3-methyl-4-phenyl-3-phenylsulfanylazetidin-2-one |
|---|---|
| PubChem CID | 134919527 |
| Molecular Formula | C18H19NOS |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | (3S,4R)-1-ethyl-3-methyl-4-phenyl-3-phenylsulfanylazetidin-2-one |
| SMILES | CCN1C(=O)[C@@](C)(Sc2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H19NOS/c1-3-19-16(14-10-6-4-7-11-14)18(2,17(19)20)21-15-12-8-5-9-13-15/h4-13,16H,3H2,1-2H3/t16-,18+/m1/s1 |
| InChIKey | GRBLOOVXRVYHEK-AEFFLSMTSA-N |
| XLogP | 4.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |