About 4-ethyl-2-pentyl-6,6-diphenyl-5H-1,3-selenazin-4-ol
4-ethyl-2-pentyl-6,6-diphenyl-5H-1,3-selenazin-4-ol (PubChem CID 134919738) has the molecular formula C23H29NOSe
and a molecular weight of 414.45 g/mol. Its IUPAC name is 4-ethyl-2-pentyl-6,6-diphenyl-5H-1,3-selenazin-4-ol.
Molecular Properties
| Compound Name | 4-ethyl-2-pentyl-6,6-diphenyl-5H-1,3-selenazin-4-ol |
| PubChem CID | 134919738 |
| Molecular Formula | C23H29NOSe |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 4-ethyl-2-pentyl-6,6-diphenyl-5H-1,3-selenazin-4-ol |
| SMILES | CCCCCC1=NC(O)(CC)CC(c2ccccc2)(c2ccccc2)[Se]1 |
| InChI | InChI=1S/C23H29NOSe/c1-3-5-8-17-21-24-22(25,4-2)18-23(26-21,19-13-9-6-10-14-19)20-15-11-7-12-16-20/h6-7,9-16,25H,3-5,8,17-18H2,1-2H3 |
| InChIKey | RTWFGHUYZQEOHH-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-2-pentyl-6,6-diphenyl-5H-1,3-selenazin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2-pentyl-6,6-diphenyl-5H-1,3-selenazin-4-ol?
The IUPAC name of 4-ethyl-2-pentyl-6,6-diphenyl-5H-1,3-selenazin-4-ol (CID 134919738) is 4-ethyl-2-pentyl-6,6-diphenyl-5H-1,3-selenazin-4-ol.
What is the SMILES notation for 4-ethyl-2-pentyl-6,6-diphenyl-5H-1,3-selenazin-4-ol?
The canonical SMILES for 4-ethyl-2-pentyl-6,6-diphenyl-5H-1,3-selenazin-4-ol is CCCCCC1=NC(O)(CC)CC(c2ccccc2)(c2ccccc2)[Se]1.
What is the InChIKey of 4-ethyl-2-pentyl-6,6-diphenyl-5H-1,3-selenazin-4-ol?
The InChIKey is RTWFGHUYZQEOHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H29NOSe/c1-3-5-8-17-21-24-22(25,4-2)18-23(26-21,19-13-9-6-10-14-19)20-15-11-7-12-16-20/h6-7,9-16,25H,3-5,8,17-18H2,1-2H3.
What are the key properties of 4-ethyl-2-pentyl-6,6-diphenyl-5H-1,3-selenazin-4-ol?
4-ethyl-2-pentyl-6,6-diphenyl-5H-1,3-selenazin-4-ol has a molecular weight of 414.45 g/mol, XLogP of 5.12, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-pentyl-6,6-diphenyl-5H-1,3-selenazin-4-ol is sourced from PubChem (CID 134919738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).