C24H23NOSe — CID 134919765
4-methyl-2-(4-methylphenyl)-6,6-diphenyl-5H-1,3-selenazin-4-ol (PubChem CID 134919765) has the molecular formula C24H23NOSe and a molecular weight of 420.41 g/mol. Its IUPAC name is 4-methyl-2-(4-methylphenyl)-6,6-diphenyl-5H-1,3-selenazin-4-ol.
| Compound Name | 4-methyl-2-(4-methylphenyl)-6,6-diphenyl-5H-1,3-selenazin-4-ol |
|---|---|
| PubChem CID | 134919765 |
| Molecular Formula | C24H23NOSe |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 4-methyl-2-(4-methylphenyl)-6,6-diphenyl-5H-1,3-selenazin-4-ol |
| SMILES | Cc1ccc(C2=NC(C)(O)CC(c3ccccc3)(c3ccccc3)[Se]2)cc1 |
| InChI | InChI=1S/C24H23NOSe/c1-18-13-15-19(16-14-18)22-25-23(2,26)17-24(27-22,20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-16,26H,17H2,1-2H3 |
| InChIKey | JDQPJQBZKRNSEL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|