About [(E)-benzylideneamino]oxymethylidene-dimethylazanium;hexachloroantimony(1-)
[(E)-benzylideneamino]oxymethylidene-dimethylazanium;hexachloroantimony(1-) (PubChem CID 134919929) has the molecular formula C10H13Cl6N2OSb
and a molecular weight of 511.71 g/mol. Its IUPAC name is [(E)-benzylideneamino]oxymethylidene-dimethylazanium;hexachloroantimony(1-).
Molecular Properties
| Compound Name | [(E)-benzylideneamino]oxymethylidene-dimethylazanium;hexachloroantimony(1-) |
| PubChem CID | 134919929 |
| Molecular Formula | C10H13Cl6N2OSb |
| Molecular Weight | 511.71 g/mol |
| Exact Mass | 507.82 |
| IUPAC Name | [(E)-benzylideneamino]oxymethylidene-dimethylazanium;hexachloroantimony(1-) |
| SMILES | C[N+](C)=CO/N=C/c1ccccc1.Cl[Sb-](Cl)(Cl)(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H13N2O.6ClH.Sb/c1-12(2)9-13-11-8-10-6-4-3-5-7-10;;;;;;;/h3-9H,1-2H3;6*1H;/q+1;;;;;;;+5/p-6/b11-8+;;;;;;; |
| InChIKey | DDWRPWBSIISUSC-PKAFVZKNSA-H |
| XLogP | 5.09 |
| TPSA | 24.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 511.71 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [(E)-benzylideneamino]oxymethylidene-dimethylazanium;hexachloroantimony(1-) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-benzylideneamino]oxymethylidene-dimethylazanium;hexachloroantimony(1-)?
The IUPAC name of [(E)-benzylideneamino]oxymethylidene-dimethylazanium;hexachloroantimony(1-) (CID 134919929) is [(E)-benzylideneamino]oxymethylidene-dimethylazanium;hexachloroantimony(1-).
What is the SMILES notation for [(E)-benzylideneamino]oxymethylidene-dimethylazanium;hexachloroantimony(1-)?
The canonical SMILES for [(E)-benzylideneamino]oxymethylidene-dimethylazanium;hexachloroantimony(1-) is C[N+](C)=CO/N=C/c1ccccc1.Cl[Sb-](Cl)(Cl)(Cl)(Cl)Cl.
What is the InChIKey of [(E)-benzylideneamino]oxymethylidene-dimethylazanium;hexachloroantimony(1-)?
The InChIKey is DDWRPWBSIISUSC-PKAFVZKNSA-H. The full InChI is InChI=1S/C10H13N2O.6ClH.Sb/c1-12(2)9-13-11-8-10-6-4-3-5-7-10;;;;;;;/h3-9H,1-2H3;6*1H;/q+1;;;;;;;+5/p-6/b11-8+;;;;;;;.
What are the key properties of [(E)-benzylideneamino]oxymethylidene-dimethylazanium;hexachloroantimony(1-)?
[(E)-benzylideneamino]oxymethylidene-dimethylazanium;hexachloroantimony(1-) has a molecular weight of 511.71 g/mol, XLogP of 5.09, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-benzylideneamino]oxymethylidene-dimethylazanium;hexachloroantimony(1-) is sourced from PubChem (CID 134919929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).