About 4-methyl-2-pentyl-6,6-diphenyl-5H-1,3-selenazin-4-ol
4-methyl-2-pentyl-6,6-diphenyl-5H-1,3-selenazin-4-ol (PubChem CID 134920167) has the molecular formula C22H27NOSe
and a molecular weight of 400.42 g/mol. Its IUPAC name is 4-methyl-2-pentyl-6,6-diphenyl-5H-1,3-selenazin-4-ol.
Molecular Properties
| Compound Name | 4-methyl-2-pentyl-6,6-diphenyl-5H-1,3-selenazin-4-ol |
| PubChem CID | 134920167 |
| Molecular Formula | C22H27NOSe |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 4-methyl-2-pentyl-6,6-diphenyl-5H-1,3-selenazin-4-ol |
| SMILES | CCCCCC1=NC(C)(O)CC(c2ccccc2)(c2ccccc2)[Se]1 |
| InChI | InChI=1S/C22H27NOSe/c1-3-4-7-16-20-23-21(2,24)17-22(25-20,18-12-8-5-9-13-18)19-14-10-6-11-15-19/h5-6,8-15,24H,3-4,7,16-17H2,1-2H3 |
| InChIKey | NVXKHKDEPRHLDA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-2-pentyl-6,6-diphenyl-5H-1,3-selenazin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-pentyl-6,6-diphenyl-5H-1,3-selenazin-4-ol?
The IUPAC name of 4-methyl-2-pentyl-6,6-diphenyl-5H-1,3-selenazin-4-ol (CID 134920167) is 4-methyl-2-pentyl-6,6-diphenyl-5H-1,3-selenazin-4-ol.
What is the SMILES notation for 4-methyl-2-pentyl-6,6-diphenyl-5H-1,3-selenazin-4-ol?
The canonical SMILES for 4-methyl-2-pentyl-6,6-diphenyl-5H-1,3-selenazin-4-ol is CCCCCC1=NC(C)(O)CC(c2ccccc2)(c2ccccc2)[Se]1.
What is the InChIKey of 4-methyl-2-pentyl-6,6-diphenyl-5H-1,3-selenazin-4-ol?
The InChIKey is NVXKHKDEPRHLDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27NOSe/c1-3-4-7-16-20-23-21(2,24)17-22(25-20,18-12-8-5-9-13-18)19-14-10-6-11-15-19/h5-6,8-15,24H,3-4,7,16-17H2,1-2H3.
What are the key properties of 4-methyl-2-pentyl-6,6-diphenyl-5H-1,3-selenazin-4-ol?
4-methyl-2-pentyl-6,6-diphenyl-5H-1,3-selenazin-4-ol has a molecular weight of 400.42 g/mol, XLogP of 4.73, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-pentyl-6,6-diphenyl-5H-1,3-selenazin-4-ol is sourced from PubChem (CID 134920167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).