C18H12F13NO6 — CID 134920169
methyl 3-[1-[2-[4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]-1,2,2-trifluoroethoxy]-1,1,2,3,3,3-hexafluoropropan-2-yl]oxy-2,2,3,3-tetrafluoropropanoate (PubChem CID 134920169) has the molecular formula C18H12F13NO6 and a molecular weight of 585.27 g/mol. Its IUPAC name is methyl 3-[1-[2-[4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]-1,2,2-trifluoroethoxy]-1,1,2,3,3,3-hexafluoropropan-2-yl]oxy-2,2,3,3-tetrafluoropropanoate.
| Compound Name | methyl 3-[1-[2-[4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]-1,2,2-trifluoroethoxy]-1,1,2,3,3,3-hexafluoropropan-2-yl]oxy-2,2,3,3-tetrafluoropropanoate |
|---|---|
| PubChem CID | 134920169 |
| Molecular Formula | C18H12F13NO6 |
| Molecular Weight | 585.27 g/mol |
| Exact Mass | 585.05 |
| IUPAC Name | methyl 3-[1-[2-[4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]-1,2,2-trifluoroethoxy]-1,1,2,3,3,3-hexafluoropropan-2-yl]oxy-2,2,3,3-tetrafluoropropanoate |
| SMILES | COC(=O)C(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)C(F)(F)Oc1ccc(C2=NCCO2)cc1 |
| InChI | InChI=1S/C18H12F13NO6/c1-34-12(33)13(20,21)17(28,29)38-15(24,16(25,26)27)18(30,31)37-11(19)14(22,23)36-9-4-2-8(3-5-9)10-32-6-7-35-10/h2-5,11H,6-7H2,1H3 |
| InChIKey | YPUPIUFQGWTWSD-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.27 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|