About (4-methylphenyl) (E)-N-(2,6-dimethylphenyl)-2-oxo-5-phenylpent-4-enimidotelluroate
(4-methylphenyl) (E)-N-(2,6-dimethylphenyl)-2-oxo-5-phenylpent-4-enimidotelluroate (PubChem CID 134920254) has the molecular formula C26H25NOTe
and a molecular weight of 495.09 g/mol. Its IUPAC name is (4-methylphenyl) (E)-N-(2,6-dimethylphenyl)-2-oxo-5-phenylpent-4-enimidotelluroate.
Molecular Properties
| Compound Name | (4-methylphenyl) (E)-N-(2,6-dimethylphenyl)-2-oxo-5-phenylpent-4-enimidotelluroate |
| PubChem CID | 134920254 |
| Molecular Formula | C26H25NOTe |
| Molecular Weight | 495.09 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | (4-methylphenyl) (E)-N-(2,6-dimethylphenyl)-2-oxo-5-phenylpent-4-enimidotelluroate |
| SMILES | Cc1ccc([Te]/C(=N\c2c(C)cccc2C)C(=O)C/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C26H25NOTe/c1-19-15-17-23(18-16-19)29-26(27-25-20(2)9-7-10-21(25)3)24(28)14-8-13-22-11-5-4-6-12-22/h4-13,15-18H,14H2,1-3H3/b13-8+,27-26- |
| InChIKey | GFCWUTAIBRCQEB-KNGQAUQJSA-N |
| XLogP | 5.34 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 495.09 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (4-methylphenyl) (E)-N-(2,6-dimethylphenyl)-2-oxo-5-phenylpent-4-enimidotelluroate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl) (E)-N-(2,6-dimethylphenyl)-2-oxo-5-phenylpent-4-enimidotelluroate?
The IUPAC name of (4-methylphenyl) (E)-N-(2,6-dimethylphenyl)-2-oxo-5-phenylpent-4-enimidotelluroate (CID 134920254) is (4-methylphenyl) (E)-N-(2,6-dimethylphenyl)-2-oxo-5-phenylpent-4-enimidotelluroate.
What is the SMILES notation for (4-methylphenyl) (E)-N-(2,6-dimethylphenyl)-2-oxo-5-phenylpent-4-enimidotelluroate?
The canonical SMILES for (4-methylphenyl) (E)-N-(2,6-dimethylphenyl)-2-oxo-5-phenylpent-4-enimidotelluroate is Cc1ccc([Te]/C(=N\c2c(C)cccc2C)C(=O)C/C=C/c2ccccc2)cc1.
What is the InChIKey of (4-methylphenyl) (E)-N-(2,6-dimethylphenyl)-2-oxo-5-phenylpent-4-enimidotelluroate?
The InChIKey is GFCWUTAIBRCQEB-KNGQAUQJSA-N. The full InChI is InChI=1S/C26H25NOTe/c1-19-15-17-23(18-16-19)29-26(27-25-20(2)9-7-10-21(25)3)24(28)14-8-13-22-11-5-4-6-12-22/h4-13,15-18H,14H2,1-3H3/b13-8+,27-26-.
What are the key properties of (4-methylphenyl) (E)-N-(2,6-dimethylphenyl)-2-oxo-5-phenylpent-4-enimidotelluroate?
(4-methylphenyl) (E)-N-(2,6-dimethylphenyl)-2-oxo-5-phenylpent-4-enimidotelluroate has a molecular weight of 495.09 g/mol, XLogP of 5.34, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl) (E)-N-(2,6-dimethylphenyl)-2-oxo-5-phenylpent-4-enimidotelluroate is sourced from PubChem (CID 134920254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).