About N,N'-ditert-butyl-N'-dimethylboranyloxamide
N,N'-ditert-butyl-N'-dimethylboranyloxamide (PubChem CID 134920383) has the molecular formula C12H25BN2O2
and a molecular weight of 240.16 g/mol. Its IUPAC name is N,N'-ditert-butyl-N'-dimethylboranyloxamide.
Molecular Properties
| Compound Name | N,N'-ditert-butyl-N'-dimethylboranyloxamide |
| PubChem CID | 134920383 |
| Molecular Formula | C12H25BN2O2 |
| Molecular Weight | 240.16 g/mol |
| Exact Mass | 240.20 |
| IUPAC Name | N,N'-ditert-butyl-N'-dimethylboranyloxamide |
| SMILES | CB(C)N(C(=O)C(=O)NC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H25BN2O2/c1-11(2,3)14-9(16)10(17)15(13(7)8)12(4,5)6/h1-8H3,(H,14,16) |
| InChIKey | UBVHYUHVSBFYRU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.16 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N,N'-ditert-butyl-N'-dimethylboranyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-ditert-butyl-N'-dimethylboranyloxamide?
The IUPAC name of N,N'-ditert-butyl-N'-dimethylboranyloxamide (CID 134920383) is N,N'-ditert-butyl-N'-dimethylboranyloxamide.
What is the SMILES notation for N,N'-ditert-butyl-N'-dimethylboranyloxamide?
The canonical SMILES for N,N'-ditert-butyl-N'-dimethylboranyloxamide is CB(C)N(C(=O)C(=O)NC(C)(C)C)C(C)(C)C.
What is the InChIKey of N,N'-ditert-butyl-N'-dimethylboranyloxamide?
The InChIKey is UBVHYUHVSBFYRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25BN2O2/c1-11(2,3)14-9(16)10(17)15(13(7)8)12(4,5)6/h1-8H3,(H,14,16).
What are the key properties of N,N'-ditert-butyl-N'-dimethylboranyloxamide?
N,N'-ditert-butyl-N'-dimethylboranyloxamide has a molecular weight of 240.16 g/mol, XLogP of 1.78, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-ditert-butyl-N'-dimethylboranyloxamide is sourced from PubChem (CID 134920383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).