About (E)-N-(triphenyl-λ5-phosphanylidene)but-2-enamide
(E)-N-(triphenyl-λ5-phosphanylidene)but-2-enamide (PubChem CID 134920386) has the molecular formula C22H20NOP
and a molecular weight of 345.38 g/mol. Its IUPAC name is (E)-N-(triphenyl-λ5-phosphanylidene)but-2-enamide.
Molecular Properties
| Compound Name | (E)-N-(triphenyl-λ5-phosphanylidene)but-2-enamide |
| PubChem CID | 134920386 |
| Molecular Formula | C22H20NOP |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | (E)-N-(triphenyl-λ5-phosphanylidene)but-2-enamide |
| SMILES | C/C=C/C(=O)N=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H20NOP/c1-2-12-22(24)23-25(19-13-6-3-7-14-19,20-15-8-4-9-16-20)21-17-10-5-11-18-21/h2-18H,1H3/b12-2+ |
| InChIKey | VLWFZWISZWHSMO-SWGQDTFXSA-N |
| XLogP | 4.27 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-(triphenyl-λ5-phosphanylidene)but-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-(triphenyl-λ5-phosphanylidene)but-2-enamide?
The IUPAC name of (E)-N-(triphenyl-λ5-phosphanylidene)but-2-enamide (CID 134920386) is (E)-N-(triphenyl-λ5-phosphanylidene)but-2-enamide.
What is the SMILES notation for (E)-N-(triphenyl-λ5-phosphanylidene)but-2-enamide?
The canonical SMILES for (E)-N-(triphenyl-λ5-phosphanylidene)but-2-enamide is C/C=C/C(=O)N=P(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of (E)-N-(triphenyl-λ5-phosphanylidene)but-2-enamide?
The InChIKey is VLWFZWISZWHSMO-SWGQDTFXSA-N. The full InChI is InChI=1S/C22H20NOP/c1-2-12-22(24)23-25(19-13-6-3-7-14-19,20-15-8-4-9-16-20)21-17-10-5-11-18-21/h2-18H,1H3/b12-2+.
What are the key properties of (E)-N-(triphenyl-λ5-phosphanylidene)but-2-enamide?
(E)-N-(triphenyl-λ5-phosphanylidene)but-2-enamide has a molecular weight of 345.38 g/mol, XLogP of 4.27, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-(triphenyl-λ5-phosphanylidene)but-2-enamide is sourced from PubChem (CID 134920386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).