About 2-(dimethyl-λ4-sulfanylidene)-1-phenyl-2-(trifluoromethylsulfonyl)ethanone
2-(dimethyl-λ4-sulfanylidene)-1-phenyl-2-(trifluoromethylsulfonyl)ethanone (PubChem CID 134920449) has the molecular formula C11H11F3O3S2
and a molecular weight of 312.33 g/mol. Its IUPAC name is 2-(dimethyl-λ4-sulfanylidene)-1-phenyl-2-(trifluoromethylsulfonyl)ethanone.
Molecular Properties
| Compound Name | 2-(dimethyl-λ4-sulfanylidene)-1-phenyl-2-(trifluoromethylsulfonyl)ethanone |
| PubChem CID | 134920449 |
| Molecular Formula | C11H11F3O3S2 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 2-(dimethyl-λ4-sulfanylidene)-1-phenyl-2-(trifluoromethylsulfonyl)ethanone |
| SMILES | CS(C)=C(C(=O)c1ccccc1)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C11H11F3O3S2/c1-18(2)10(19(16,17)11(12,13)14)9(15)8-6-4-3-5-7-8/h3-7H,1-2H3 |
| InChIKey | VTFYBIDDWJOJFF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethyl-λ4-sulfanylidene)-1-phenyl-2-(trifluoromethylsulfonyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethyl-λ4-sulfanylidene)-1-phenyl-2-(trifluoromethylsulfonyl)ethanone?
The IUPAC name of 2-(dimethyl-λ4-sulfanylidene)-1-phenyl-2-(trifluoromethylsulfonyl)ethanone (CID 134920449) is 2-(dimethyl-λ4-sulfanylidene)-1-phenyl-2-(trifluoromethylsulfonyl)ethanone.
What is the SMILES notation for 2-(dimethyl-λ4-sulfanylidene)-1-phenyl-2-(trifluoromethylsulfonyl)ethanone?
The canonical SMILES for 2-(dimethyl-λ4-sulfanylidene)-1-phenyl-2-(trifluoromethylsulfonyl)ethanone is CS(C)=C(C(=O)c1ccccc1)S(=O)(=O)C(F)(F)F.
What is the InChIKey of 2-(dimethyl-λ4-sulfanylidene)-1-phenyl-2-(trifluoromethylsulfonyl)ethanone?
The InChIKey is VTFYBIDDWJOJFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F3O3S2/c1-18(2)10(19(16,17)11(12,13)14)9(15)8-6-4-3-5-7-8/h3-7H,1-2H3.
What are the key properties of 2-(dimethyl-λ4-sulfanylidene)-1-phenyl-2-(trifluoromethylsulfonyl)ethanone?
2-(dimethyl-λ4-sulfanylidene)-1-phenyl-2-(trifluoromethylsulfonyl)ethanone has a molecular weight of 312.33 g/mol, XLogP of 2.46, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethyl-λ4-sulfanylidene)-1-phenyl-2-(trifluoromethylsulfonyl)ethanone is sourced from PubChem (CID 134920449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).