C17H10F6S — CID 134920472
16-fluoro-16-(1,1,2,2,2-pentafluoroethyl)-15-thiatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene (PubChem CID 134920472) has the molecular formula C17H10F6S and a molecular weight of 360.32 g/mol. Its IUPAC name is 16-fluoro-16-(1,1,2,2,2-pentafluoroethyl)-15-thiatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene.
| Compound Name | 16-fluoro-16-(1,1,2,2,2-pentafluoroethyl)-15-thiatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene |
|---|---|
| PubChem CID | 134920472 |
| Molecular Formula | C17H10F6S |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 16-fluoro-16-(1,1,2,2,2-pentafluoroethyl)-15-thiatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene |
| SMILES | FC(F)(F)C(F)(F)C1(F)SC2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C17H10F6S/c18-15(16(19,20)17(21,22)23)13-9-5-1-3-7-11(9)14(24-15)12-8-4-2-6-10(12)13/h1-8,13-14H |
| InChIKey | VJGPGGLEAFTCOU-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|