C18H19NO3S — CID 134920504
(4S,5S)-5-methyl-1-(4-methylphenyl)sulfonyl-4-phenylpyrrolidin-2-one (PubChem CID 134920504) has the molecular formula C18H19NO3S and a molecular weight of 329.42 g/mol. Its IUPAC name is (4S,5S)-5-methyl-1-(4-methylphenyl)sulfonyl-4-phenylpyrrolidin-2-one.
| Compound Name | (4S,5S)-5-methyl-1-(4-methylphenyl)sulfonyl-4-phenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 134920504 |
| Molecular Formula | C18H19NO3S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | (4S,5S)-5-methyl-1-(4-methylphenyl)sulfonyl-4-phenylpyrrolidin-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)C[C@@H](c3ccccc3)[C@@H]2C)cc1 |
| InChI | InChI=1S/C18H19NO3S/c1-13-8-10-16(11-9-13)23(21,22)19-14(2)17(12-18(19)20)15-6-4-3-5-7-15/h3-11,14,17H,12H2,1-2H3/t14-,17+/m0/s1 |
| InChIKey | RNNJHFDYOFDPFW-WMLDXEAASA-N |
| XLogP | 3.09 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |