About 4-(trifluoromethyl)-N-[2,4,6-tri(propan-2-yl)phenyl]sulfonylbenzamide
4-(trifluoromethyl)-N-[2,4,6-tri(propan-2-yl)phenyl]sulfonylbenzamide (PubChem CID 134920573) has the molecular formula C23H28F3NO3S
and a molecular weight of 455.54 g/mol. Its IUPAC name is 4-(trifluoromethyl)-N-[2,4,6-tri(propan-2-yl)phenyl]sulfonylbenzamide.
Molecular Properties
| Compound Name | 4-(trifluoromethyl)-N-[2,4,6-tri(propan-2-yl)phenyl]sulfonylbenzamide |
| PubChem CID | 134920573 |
| Molecular Formula | C23H28F3NO3S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 4-(trifluoromethyl)-N-[2,4,6-tri(propan-2-yl)phenyl]sulfonylbenzamide |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)NC(=O)c2ccc(C(F)(F)F)cc2)c(C(C)C)c1 |
| InChI | InChI=1S/C23H28F3NO3S/c1-13(2)17-11-19(14(3)4)21(20(12-17)15(5)6)31(29,30)27-22(28)16-7-9-18(10-8-16)23(24,25)26/h7-15H,1-6H3,(H,27,28) |
| InChIKey | IHVBOMDZGQMXTG-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(trifluoromethyl)-N-[2,4,6-tri(propan-2-yl)phenyl]sulfonylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(trifluoromethyl)-N-[2,4,6-tri(propan-2-yl)phenyl]sulfonylbenzamide?
The IUPAC name of 4-(trifluoromethyl)-N-[2,4,6-tri(propan-2-yl)phenyl]sulfonylbenzamide (CID 134920573) is 4-(trifluoromethyl)-N-[2,4,6-tri(propan-2-yl)phenyl]sulfonylbenzamide.
What is the SMILES notation for 4-(trifluoromethyl)-N-[2,4,6-tri(propan-2-yl)phenyl]sulfonylbenzamide?
The canonical SMILES for 4-(trifluoromethyl)-N-[2,4,6-tri(propan-2-yl)phenyl]sulfonylbenzamide is CC(C)c1cc(C(C)C)c(S(=O)(=O)NC(=O)c2ccc(C(F)(F)F)cc2)c(C(C)C)c1.
What is the InChIKey of 4-(trifluoromethyl)-N-[2,4,6-tri(propan-2-yl)phenyl]sulfonylbenzamide?
The InChIKey is IHVBOMDZGQMXTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28F3NO3S/c1-13(2)17-11-19(14(3)4)21(20(12-17)15(5)6)31(29,30)27-22(28)16-7-9-18(10-8-16)23(24,25)26/h7-15H,1-6H3,(H,27,28).
What are the key properties of 4-(trifluoromethyl)-N-[2,4,6-tri(propan-2-yl)phenyl]sulfonylbenzamide?
4-(trifluoromethyl)-N-[2,4,6-tri(propan-2-yl)phenyl]sulfonylbenzamide has a molecular weight of 455.54 g/mol, XLogP of 6.19, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(trifluoromethyl)-N-[2,4,6-tri(propan-2-yl)phenyl]sulfonylbenzamide is sourced from PubChem (CID 134920573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).