C10H4Br2Cl4S — CID 134920803
1-chloro-4-[(1Z)-1,2-dibromo-3,4,4-trichlorobuta-1,3-dienyl]sulfanylbenzene (PubChem CID 134920803) has the molecular formula C10H4Br2Cl4S and a molecular weight of 457.83 g/mol. Its IUPAC name is 1-chloro-4-[(1Z)-1,2-dibromo-3,4,4-trichlorobuta-1,3-dienyl]sulfanylbenzene.
| Compound Name | 1-chloro-4-[(1Z)-1,2-dibromo-3,4,4-trichlorobuta-1,3-dienyl]sulfanylbenzene |
|---|---|
| PubChem CID | 134920803 |
| Molecular Formula | C10H4Br2Cl4S |
| Molecular Weight | 457.83 g/mol |
| Exact Mass | 453.72 |
| IUPAC Name | 1-chloro-4-[(1Z)-1,2-dibromo-3,4,4-trichlorobuta-1,3-dienyl]sulfanylbenzene |
| SMILES | ClC(Cl)=C(Cl)/C(Br)=C(/Br)Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H4Br2Cl4S/c11-7(8(14)10(15)16)9(12)17-6-3-1-5(13)2-4-6/h1-4H/b9-7+ |
| InChIKey | NVNKMJRKTFEGBG-VQHVLOKHSA-N |
| XLogP | 7.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.83 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|