C26H38OS — CID 134920820
[(1Z,3Z)-1-cyclohexyl-2-prop-2-enoxyundeca-1,3-dien-3-yl]sulfanylbenzene (PubChem CID 134920820) has the molecular formula C26H38OS and a molecular weight of 398.66 g/mol. Its IUPAC name is [(1Z,3Z)-1-cyclohexyl-2-prop-2-enoxyundeca-1,3-dien-3-yl]sulfanylbenzene.
| Compound Name | [(1Z,3Z)-1-cyclohexyl-2-prop-2-enoxyundeca-1,3-dien-3-yl]sulfanylbenzene |
|---|---|
| PubChem CID | 134920820 |
| Molecular Formula | C26H38OS |
| Molecular Weight | 398.66 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | [(1Z,3Z)-1-cyclohexyl-2-prop-2-enoxyundeca-1,3-dien-3-yl]sulfanylbenzene |
| SMILES | C=CCOC(=C\C1CCCCC1)/C(=C/CCCCCCC)Sc1ccccc1 |
| InChI | InChI=1S/C26H38OS/c1-3-5-6-7-8-15-20-26(28-24-18-13-10-14-19-24)25(27-21-4-2)22-23-16-11-9-12-17-23/h4,10,13-14,18-20,22-23H,2-3,5-9,11-12,15-17,21H2,1H3/b25-22-,26-20- |
| InChIKey | MKCWCOPJJGFBAN-WDQXOPQFSA-N |
| XLogP | 8.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.66 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|