C16H18Cl3N3O2S — CID 134920861
1-methyl-4-[(1Z)-3,4,4-trichloro-1-(4-methylphenyl)sulfanyl-2-nitrobuta-1,3-dienyl]piperazine (PubChem CID 134920861) has the molecular formula C16H18Cl3N3O2S and a molecular weight of 422.77 g/mol. Its IUPAC name is 1-methyl-4-[(1Z)-3,4,4-trichloro-1-(4-methylphenyl)sulfanyl-2-nitrobuta-1,3-dienyl]piperazine.
| Compound Name | 1-methyl-4-[(1Z)-3,4,4-trichloro-1-(4-methylphenyl)sulfanyl-2-nitrobuta-1,3-dienyl]piperazine |
|---|---|
| PubChem CID | 134920861 |
| Molecular Formula | C16H18Cl3N3O2S |
| Molecular Weight | 422.77 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | 1-methyl-4-[(1Z)-3,4,4-trichloro-1-(4-methylphenyl)sulfanyl-2-nitrobuta-1,3-dienyl]piperazine |
| SMILES | Cc1ccc(S/C(=C(/C(Cl)=C(Cl)Cl)[N+](=O)[O-])N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C16H18Cl3N3O2S/c1-11-3-5-12(6-4-11)25-16(21-9-7-20(2)8-10-21)14(22(23)24)13(17)15(18)19/h3-6H,7-10H2,1-2H3/b16-14- |
| InChIKey | VGMCSEIVPYTYDY-PEZBUJJGSA-N |
| XLogP | 4.67 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.77 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|