About N-butyl-N-[(Z)-1,2-dichloro-3-imidazolidin-2-ylidene-3-nitroprop-1-enyl]butan-1-amine
N-butyl-N-[(Z)-1,2-dichloro-3-imidazolidin-2-ylidene-3-nitroprop-1-enyl]butan-1-amine (PubChem CID 134920921) has the molecular formula C14H24Cl2N4O2
and a molecular weight of 351.28 g/mol. Its IUPAC name is N-butyl-N-[(Z)-1,2-dichloro-3-imidazolidin-2-ylidene-3-nitroprop-1-enyl]butan-1-amine.
Molecular Properties
| Compound Name | N-butyl-N-[(Z)-1,2-dichloro-3-imidazolidin-2-ylidene-3-nitroprop-1-enyl]butan-1-amine |
| PubChem CID | 134920921 |
| Molecular Formula | C14H24Cl2N4O2 |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | N-butyl-N-[(Z)-1,2-dichloro-3-imidazolidin-2-ylidene-3-nitroprop-1-enyl]butan-1-amine |
| SMILES | CCCCN(CCCC)/C(Cl)=C(/Cl)C(=C1NCCN1)[N+](=O)[O-] |
| InChI | InChI=1S/C14H24Cl2N4O2/c1-3-5-9-19(10-6-4-2)13(16)11(15)12(20(21)22)14-17-7-8-18-14/h17-18H,3-10H2,1-2H3/b13-11+ |
| InChIKey | HFLLGNQNDWUFIJ-ACCUITESSA-N |
| XLogP | 3.17 |
| TPSA | 70.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-N-[(Z)-1,2-dichloro-3-imidazolidin-2-ylidene-3-nitroprop-1-enyl]butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N-[(Z)-1,2-dichloro-3-imidazolidin-2-ylidene-3-nitroprop-1-enyl]butan-1-amine?
The IUPAC name of N-butyl-N-[(Z)-1,2-dichloro-3-imidazolidin-2-ylidene-3-nitroprop-1-enyl]butan-1-amine (CID 134920921) is N-butyl-N-[(Z)-1,2-dichloro-3-imidazolidin-2-ylidene-3-nitroprop-1-enyl]butan-1-amine.
What is the SMILES notation for N-butyl-N-[(Z)-1,2-dichloro-3-imidazolidin-2-ylidene-3-nitroprop-1-enyl]butan-1-amine?
The canonical SMILES for N-butyl-N-[(Z)-1,2-dichloro-3-imidazolidin-2-ylidene-3-nitroprop-1-enyl]butan-1-amine is CCCCN(CCCC)/C(Cl)=C(/Cl)C(=C1NCCN1)[N+](=O)[O-].
What is the InChIKey of N-butyl-N-[(Z)-1,2-dichloro-3-imidazolidin-2-ylidene-3-nitroprop-1-enyl]butan-1-amine?
The InChIKey is HFLLGNQNDWUFIJ-ACCUITESSA-N. The full InChI is InChI=1S/C14H24Cl2N4O2/c1-3-5-9-19(10-6-4-2)13(16)11(15)12(20(21)22)14-17-7-8-18-14/h17-18H,3-10H2,1-2H3/b13-11+.
What are the key properties of N-butyl-N-[(Z)-1,2-dichloro-3-imidazolidin-2-ylidene-3-nitroprop-1-enyl]butan-1-amine?
N-butyl-N-[(Z)-1,2-dichloro-3-imidazolidin-2-ylidene-3-nitroprop-1-enyl]butan-1-amine has a molecular weight of 351.28 g/mol, XLogP of 3.17, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N-[(Z)-1,2-dichloro-3-imidazolidin-2-ylidene-3-nitroprop-1-enyl]butan-1-amine is sourced from PubChem (CID 134920921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).