C20H25FO2S — CID 134920966
[(1E)-1-fluoro-2-methyl-3-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]sulfonylbenzene (PubChem CID 134920966) has the molecular formula C20H25FO2S and a molecular weight of 348.48 g/mol. Its IUPAC name is [(1E)-1-fluoro-2-methyl-3-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]sulfonylbenzene.
| Compound Name | [(1E)-1-fluoro-2-methyl-3-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]sulfonylbenzene |
|---|---|
| PubChem CID | 134920966 |
| Molecular Formula | C20H25FO2S |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | [(1E)-1-fluoro-2-methyl-3-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]sulfonylbenzene |
| SMILES | C=C(C1=C(C)CCCC1(C)C)/C(C)=C(\F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H25FO2S/c1-14-10-9-13-20(4,5)18(14)15(2)16(3)19(21)24(22,23)17-11-7-6-8-12-17/h6-8,11-12H,2,9-10,13H2,1,3-5H3/b19-16+ |
| InChIKey | LWMJFJPFVGWYPB-KNTRCKAVSA-N |
| XLogP | 5.74 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|