C14H14F16O3 — CID 134921020
1-[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethoxy]hexane (PubChem CID 134921020) has the molecular formula C14H14F16O3 and a molecular weight of 534.23 g/mol. Its IUPAC name is 1-[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethoxy]hexane.
| Compound Name | 1-[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethoxy]hexane |
|---|---|
| PubChem CID | 134921020 |
| Molecular Formula | C14H14F16O3 |
| Molecular Weight | 534.23 g/mol |
| Exact Mass | 534.07 |
| IUPAC Name | 1-[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethoxy]hexane |
| SMILES | CCCCCCOC(F)(F)C(F)OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H14F16O3/c1-2-3-4-5-6-31-8(16,17)7(15)32-14(29,30)10(20,12(24,25)26)33-13(27,28)9(18,19)11(21,22)23/h7H,2-6H2,1H3 |
| InChIKey | MXMYWZCSPZRBAB-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.23 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|