C20H19NO7S — CID 134921040
ethyl (2R,3S)-2-(benzenesulfonyl)-5-methyl-3-(4-nitrophenyl)-2,3-dihydrofuran-4-carboxylate (PubChem CID 134921040) has the molecular formula C20H19NO7S and a molecular weight of 417.44 g/mol. Its IUPAC name is ethyl (2R,3S)-2-(benzenesulfonyl)-5-methyl-3-(4-nitrophenyl)-2,3-dihydrofuran-4-carboxylate.
| Compound Name | ethyl (2R,3S)-2-(benzenesulfonyl)-5-methyl-3-(4-nitrophenyl)-2,3-dihydrofuran-4-carboxylate |
|---|---|
| PubChem CID | 134921040 |
| Molecular Formula | C20H19NO7S |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | ethyl (2R,3S)-2-(benzenesulfonyl)-5-methyl-3-(4-nitrophenyl)-2,3-dihydrofuran-4-carboxylate |
| SMILES | CCOC(=O)C1=C(C)O[C@H](S(=O)(=O)c2ccccc2)[C@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H19NO7S/c1-3-27-19(22)17-13(2)28-20(29(25,26)16-7-5-4-6-8-16)18(17)14-9-11-15(12-10-14)21(23)24/h4-12,18,20H,3H2,1-2H3/t18-,20+/m0/s1 |
| InChIKey | OYOAPNUHANSMIN-AZUAARDMSA-N |
| XLogP | 3.35 |
| TPSA | 112.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|