C22H20Cl3FN2O2S — CID 134921055
4-(4-fluorophenyl)-1-[(1Z)-3,4,4-trichloro-1-(4-methylphenyl)sulfanyl-2-nitrobuta-1,3-dienyl]piperidine (PubChem CID 134921055) has the molecular formula C22H20Cl3FN2O2S and a molecular weight of 501.84 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-1-[(1Z)-3,4,4-trichloro-1-(4-methylphenyl)sulfanyl-2-nitrobuta-1,3-dienyl]piperidine.
| Compound Name | 4-(4-fluorophenyl)-1-[(1Z)-3,4,4-trichloro-1-(4-methylphenyl)sulfanyl-2-nitrobuta-1,3-dienyl]piperidine |
|---|---|
| PubChem CID | 134921055 |
| Molecular Formula | C22H20Cl3FN2O2S |
| Molecular Weight | 501.84 g/mol |
| Exact Mass | 500.03 |
| IUPAC Name | 4-(4-fluorophenyl)-1-[(1Z)-3,4,4-trichloro-1-(4-methylphenyl)sulfanyl-2-nitrobuta-1,3-dienyl]piperidine |
| SMILES | Cc1ccc(S/C(=C(/C(Cl)=C(Cl)Cl)[N+](=O)[O-])N2CCC(c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H20Cl3FN2O2S/c1-14-2-8-18(9-3-14)31-22(20(28(29)30)19(23)21(24)25)27-12-10-16(11-13-27)15-4-6-17(26)7-5-15/h2-9,16H,10-13H2,1H3/b22-20- |
| InChIKey | KITRFQAARVJNFP-XDOYNYLZSA-N |
| XLogP | 7.44 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.84 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|