C19H30N4 — CID 134921070
3-[4-(dimethylamino)phenyl]imino-1-N,1-N,2-N,2-N-tetraethylcyclopropene-1,2-diamine (PubChem CID 134921070) has the molecular formula C19H30N4 and a molecular weight of 314.48 g/mol. Its IUPAC name is 3-[4-(dimethylamino)phenyl]imino-1-N,1-N,2-N,2-N-tetraethylcyclopropene-1,2-diamine.
| Compound Name | 3-[4-(dimethylamino)phenyl]imino-1-N,1-N,2-N,2-N-tetraethylcyclopropene-1,2-diamine |
|---|---|
| PubChem CID | 134921070 |
| Molecular Formula | C19H30N4 |
| Molecular Weight | 314.48 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | 3-[4-(dimethylamino)phenyl]imino-1-N,1-N,2-N,2-N-tetraethylcyclopropene-1,2-diamine |
| SMILES | CCN(CC)c1c(N(CC)CC)c1=Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C19H30N4/c1-7-22(8-2)18-17(19(18)23(9-3)10-4)20-15-11-13-16(14-12-15)21(5)6/h11-14H,7-10H2,1-6H3 |
| InChIKey | CBWHZUMERRBTIZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|