About (5S)-2-amino-5-butyl-5-phenylcyclopenta-1,3-diene-1-carbonitrile
(5S)-2-amino-5-butyl-5-phenylcyclopenta-1,3-diene-1-carbonitrile (PubChem CID 134921096) has the molecular formula C16H18N2
and a molecular weight of 238.33 g/mol. Its IUPAC name is (5S)-2-amino-5-butyl-5-phenylcyclopenta-1,3-diene-1-carbonitrile.
Molecular Properties
| Compound Name | (5S)-2-amino-5-butyl-5-phenylcyclopenta-1,3-diene-1-carbonitrile |
| PubChem CID | 134921096 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | (5S)-2-amino-5-butyl-5-phenylcyclopenta-1,3-diene-1-carbonitrile |
| SMILES | CCCC[C@@]1(c2ccccc2)C=CC(N)=C1C#N |
| InChI | InChI=1S/C16H18N2/c1-2-3-10-16(13-7-5-4-6-8-13)11-9-15(18)14(16)12-17/h4-9,11H,2-3,10,18H2,1H3/t16-/m0/s1 |
| InChIKey | CBQPKUABQGIEGS-INIZCTEOSA-N |
| XLogP | 3.42 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S)-2-amino-5-butyl-5-phenylcyclopenta-1,3-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-2-amino-5-butyl-5-phenylcyclopenta-1,3-diene-1-carbonitrile?
The IUPAC name of (5S)-2-amino-5-butyl-5-phenylcyclopenta-1,3-diene-1-carbonitrile (CID 134921096) is (5S)-2-amino-5-butyl-5-phenylcyclopenta-1,3-diene-1-carbonitrile.
What is the SMILES notation for (5S)-2-amino-5-butyl-5-phenylcyclopenta-1,3-diene-1-carbonitrile?
The canonical SMILES for (5S)-2-amino-5-butyl-5-phenylcyclopenta-1,3-diene-1-carbonitrile is CCCC[C@@]1(c2ccccc2)C=CC(N)=C1C#N.
What is the InChIKey of (5S)-2-amino-5-butyl-5-phenylcyclopenta-1,3-diene-1-carbonitrile?
The InChIKey is CBQPKUABQGIEGS-INIZCTEOSA-N. The full InChI is InChI=1S/C16H18N2/c1-2-3-10-16(13-7-5-4-6-8-13)11-9-15(18)14(16)12-17/h4-9,11H,2-3,10,18H2,1H3/t16-/m0/s1.
What are the key properties of (5S)-2-amino-5-butyl-5-phenylcyclopenta-1,3-diene-1-carbonitrile?
(5S)-2-amino-5-butyl-5-phenylcyclopenta-1,3-diene-1-carbonitrile has a molecular weight of 238.33 g/mol, XLogP of 3.42, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-2-amino-5-butyl-5-phenylcyclopenta-1,3-diene-1-carbonitrile is sourced from PubChem (CID 134921096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).