About 4,6-diethoxypyrimidine
4,6-diethoxypyrimidine (PubChem CID 13492145) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is 4,6-diethoxypyrimidine.
Molecular Properties
| Compound Name | 4,6-diethoxypyrimidine |
| PubChem CID | 13492145 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 4,6-diethoxypyrimidine |
| SMILES | CCOc1cc(OCC)ncn1 |
| InChI | InChI=1S/C8H12N2O2/c1-3-11-7-5-8(12-4-2)10-6-9-7/h5-6H,3-4H2,1-2H3 |
| InChIKey | WFUDIWSUZYDRST-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,6-diethoxypyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-diethoxypyrimidine?
The IUPAC name of 4,6-diethoxypyrimidine (CID 13492145) is 4,6-diethoxypyrimidine.
What is the SMILES notation for 4,6-diethoxypyrimidine?
The canonical SMILES for 4,6-diethoxypyrimidine is CCOc1cc(OCC)ncn1.
What is the InChIKey of 4,6-diethoxypyrimidine?
The InChIKey is WFUDIWSUZYDRST-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c1-3-11-7-5-8(12-4-2)10-6-9-7/h5-6H,3-4H2,1-2H3.
What are the key properties of 4,6-diethoxypyrimidine?
4,6-diethoxypyrimidine has a molecular weight of 168.20 g/mol, XLogP of 1.27, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-diethoxypyrimidine is sourced from PubChem (CID 13492145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).