About 2-(1,3-oxazolidin-2-ylidene)-N,N'-diphenylpropanediamide
2-(1,3-oxazolidin-2-ylidene)-N,N'-diphenylpropanediamide (PubChem CID 134921502) has the molecular formula C18H17N3O3
and a molecular weight of 323.35 g/mol. Its IUPAC name is 2-(1,3-oxazolidin-2-ylidene)-N,N'-diphenylpropanediamide.
Molecular Properties
| Compound Name | 2-(1,3-oxazolidin-2-ylidene)-N,N'-diphenylpropanediamide |
| PubChem CID | 134921502 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 2-(1,3-oxazolidin-2-ylidene)-N,N'-diphenylpropanediamide |
| SMILES | O=C(Nc1ccccc1)C(C(=O)Nc1ccccc1)=C1NCCO1 |
| InChI | InChI=1S/C18H17N3O3/c22-16(20-13-7-3-1-4-8-13)15(18-19-11-12-24-18)17(23)21-14-9-5-2-6-10-14/h1-10,19H,11-12H2,(H,20,22)(H,21,23) |
| InChIKey | HZPSEVGLHGGREG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-oxazolidin-2-ylidene)-N,N'-diphenylpropanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-oxazolidin-2-ylidene)-N,N'-diphenylpropanediamide?
The IUPAC name of 2-(1,3-oxazolidin-2-ylidene)-N,N'-diphenylpropanediamide (CID 134921502) is 2-(1,3-oxazolidin-2-ylidene)-N,N'-diphenylpropanediamide.
What is the SMILES notation for 2-(1,3-oxazolidin-2-ylidene)-N,N'-diphenylpropanediamide?
The canonical SMILES for 2-(1,3-oxazolidin-2-ylidene)-N,N'-diphenylpropanediamide is O=C(Nc1ccccc1)C(C(=O)Nc1ccccc1)=C1NCCO1.
What is the InChIKey of 2-(1,3-oxazolidin-2-ylidene)-N,N'-diphenylpropanediamide?
The InChIKey is HZPSEVGLHGGREG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O3/c22-16(20-13-7-3-1-4-8-13)15(18-19-11-12-24-18)17(23)21-14-9-5-2-6-10-14/h1-10,19H,11-12H2,(H,20,22)(H,21,23).
What are the key properties of 2-(1,3-oxazolidin-2-ylidene)-N,N'-diphenylpropanediamide?
2-(1,3-oxazolidin-2-ylidene)-N,N'-diphenylpropanediamide has a molecular weight of 323.35 g/mol, XLogP of 2.10, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-oxazolidin-2-ylidene)-N,N'-diphenylpropanediamide is sourced from PubChem (CID 134921502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).