About (2E)-2-(3-methyl-1,3-benzoxazol-2-ylidene)-3-sulfanylpropanenitrile
(2E)-2-(3-methyl-1,3-benzoxazol-2-ylidene)-3-sulfanylpropanenitrile (PubChem CID 134921533) has the molecular formula C11H10N2OS
and a molecular weight of 218.28 g/mol. Its IUPAC name is (2E)-2-(3-methyl-1,3-benzoxazol-2-ylidene)-3-sulfanylpropanenitrile.
Molecular Properties
| Compound Name | (2E)-2-(3-methyl-1,3-benzoxazol-2-ylidene)-3-sulfanylpropanenitrile |
| PubChem CID | 134921533 |
| Molecular Formula | C11H10N2OS |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | (2E)-2-(3-methyl-1,3-benzoxazol-2-ylidene)-3-sulfanylpropanenitrile |
| SMILES | CN1/C(=C(/C#N)CS)Oc2ccccc21 |
| InChI | InChI=1S/C11H10N2OS/c1-13-9-4-2-3-5-10(9)14-11(13)8(6-12)7-15/h2-5,15H,7H2,1H3/b11-8+ |
| InChIKey | WTYOTMHWSPRGJZ-DHZHZOJOSA-N |
| XLogP | 2.18 |
| TPSA | 36.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-(3-methyl-1,3-benzoxazol-2-ylidene)-3-sulfanylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-(3-methyl-1,3-benzoxazol-2-ylidene)-3-sulfanylpropanenitrile?
The IUPAC name of (2E)-2-(3-methyl-1,3-benzoxazol-2-ylidene)-3-sulfanylpropanenitrile (CID 134921533) is (2E)-2-(3-methyl-1,3-benzoxazol-2-ylidene)-3-sulfanylpropanenitrile.
What is the SMILES notation for (2E)-2-(3-methyl-1,3-benzoxazol-2-ylidene)-3-sulfanylpropanenitrile?
The canonical SMILES for (2E)-2-(3-methyl-1,3-benzoxazol-2-ylidene)-3-sulfanylpropanenitrile is CN1/C(=C(/C#N)CS)Oc2ccccc21.
What is the InChIKey of (2E)-2-(3-methyl-1,3-benzoxazol-2-ylidene)-3-sulfanylpropanenitrile?
The InChIKey is WTYOTMHWSPRGJZ-DHZHZOJOSA-N. The full InChI is InChI=1S/C11H10N2OS/c1-13-9-4-2-3-5-10(9)14-11(13)8(6-12)7-15/h2-5,15H,7H2,1H3/b11-8+.
What are the key properties of (2E)-2-(3-methyl-1,3-benzoxazol-2-ylidene)-3-sulfanylpropanenitrile?
(2E)-2-(3-methyl-1,3-benzoxazol-2-ylidene)-3-sulfanylpropanenitrile has a molecular weight of 218.28 g/mol, XLogP of 2.18, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-(3-methyl-1,3-benzoxazol-2-ylidene)-3-sulfanylpropanenitrile is sourced from PubChem (CID 134921533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).