C20H18F6N2O — CID 134921578
2-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-3,5-dimethyl-4,6-diphenyl-1,3,5-oxadiazinane (PubChem CID 134921578) has the molecular formula C20H18F6N2O and a molecular weight of 416.37 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-3,5-dimethyl-4,6-diphenyl-1,3,5-oxadiazinane.
| Compound Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-3,5-dimethyl-4,6-diphenyl-1,3,5-oxadiazinane |
|---|---|
| PubChem CID | 134921578 |
| Molecular Formula | C20H18F6N2O |
| Molecular Weight | 416.37 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-3,5-dimethyl-4,6-diphenyl-1,3,5-oxadiazinane |
| SMILES | CN1C(=C(C(F)(F)F)C(F)(F)F)OC(c2ccccc2)N(C)C1c1ccccc1 |
| InChI | InChI=1S/C20H18F6N2O/c1-27-16(13-9-5-3-6-10-13)28(2)18(15(19(21,22)23)20(24,25)26)29-17(27)14-11-7-4-8-12-14/h3-12,16-17H,1-2H3 |
| InChIKey | IXLIXYWTCOWSKH-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.37 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |