C24H28O8 — CID 134921636
25,26-dihydroxy-10,23-dioxatricyclo[19.2.2.18,12]hexacosa-1(24),8,12(26),21(25)-tetraene-11,13,20,22-tetrone (PubChem CID 134921636) has the molecular formula C24H28O8 and a molecular weight of 444.48 g/mol. Its IUPAC name is 25,26-dihydroxy-10,23-dioxatricyclo[19.2.2.18,12]hexacosa-1(24),8,12(26),21(25)-tetraene-11,13,20,22-tetrone.
| Compound Name | 25,26-dihydroxy-10,23-dioxatricyclo[19.2.2.18,12]hexacosa-1(24),8,12(26),21(25)-tetraene-11,13,20,22-tetrone |
|---|---|
| PubChem CID | 134921636 |
| Molecular Formula | C24H28O8 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 25,26-dihydroxy-10,23-dioxatricyclo[19.2.2.18,12]hexacosa-1(24),8,12(26),21(25)-tetraene-11,13,20,22-tetrone |
| SMILES | O=C1CCCCCCC(=O)c2c(O)c(coc2=O)CCCCCCc2cc(O)c1c(=O)o2 |
| InChI | InChI=1S/C24H28O8/c25-17-11-7-3-4-8-12-18(26)21-22(28)15(14-31-23(21)29)9-5-1-2-6-10-16-13-19(27)20(17)24(30)32-16/h13-14,27-28H,1-12H2 |
| InChIKey | ICOFLOCHOLUGEE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 135.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |