C10H10F2OS — CID 13492169
(Z)-3,4-difluoro-4-phenylsulfanylbut-3-en-2-ol (PubChem CID 13492169) has the molecular formula C10H10F2OS and a molecular weight of 216.25 g/mol. Its IUPAC name is (Z)-3,4-difluoro-4-phenylsulfanylbut-3-en-2-ol.
| Compound Name | (Z)-3,4-difluoro-4-phenylsulfanylbut-3-en-2-ol |
|---|---|
| PubChem CID | 13492169 |
| Molecular Formula | C10H10F2OS |
| Molecular Weight | 216.25 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | (Z)-3,4-difluoro-4-phenylsulfanylbut-3-en-2-ol |
| SMILES | CC(O)/C(F)=C(\F)Sc1ccccc1 |
| InChI | InChI=1S/C10H10F2OS/c1-7(13)9(11)10(12)14-8-5-3-2-4-6-8/h2-7,13H,1H3/b10-9- |
| InChIKey | UUZSVMBZOKQOEB-KTKRTIGZSA-N |
| XLogP | 3.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.25 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |