About 1,1-dibromohexa-1,2-diene
1,1-dibromohexa-1,2-diene (PubChem CID 134921782) has the molecular formula C6H8Br2
and a molecular weight of 239.94 g/mol. Its IUPAC name is 1,1-dibromohexa-1,2-diene.
Molecular Properties
| Compound Name | 1,1-dibromohexa-1,2-diene |
| PubChem CID | 134921782 |
| Molecular Formula | C6H8Br2 |
| Molecular Weight | 239.94 g/mol |
| Exact Mass | 237.90 |
| IUPAC Name | 1,1-dibromohexa-1,2-diene |
| SMILES | CCCC=C=C(Br)Br |
| InChI | InChI=1S/C6H8Br2/c1-2-3-4-5-6(7)8/h4H,2-3H2,1H3 |
| InChIKey | QNRAUAFWVALZQM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.94 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,1-dibromohexa-1,2-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dibromohexa-1,2-diene?
The IUPAC name of 1,1-dibromohexa-1,2-diene (CID 134921782) is 1,1-dibromohexa-1,2-diene.
What is the SMILES notation for 1,1-dibromohexa-1,2-diene?
The canonical SMILES for 1,1-dibromohexa-1,2-diene is CCCC=C=C(Br)Br.
What is the InChIKey of 1,1-dibromohexa-1,2-diene?
The InChIKey is QNRAUAFWVALZQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8Br2/c1-2-3-4-5-6(7)8/h4H,2-3H2,1H3.
What are the key properties of 1,1-dibromohexa-1,2-diene?
1,1-dibromohexa-1,2-diene has a molecular weight of 239.94 g/mol, XLogP of 3.57, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dibromohexa-1,2-diene is sourced from PubChem (CID 134921782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).