About 2'-methyl-2'-prop-1-en-2-ylspiro[2-benzofuran-3,1'-cyclopropane]-1-one
2'-methyl-2'-prop-1-en-2-ylspiro[2-benzofuran-3,1'-cyclopropane]-1-one (PubChem CID 134921823) has the molecular formula C14H14O2
and a molecular weight of 214.26 g/mol. Its IUPAC name is 2'-methyl-2'-prop-1-en-2-ylspiro[2-benzofuran-3,1'-cyclopropane]-1-one.
Molecular Properties
| Compound Name | 2'-methyl-2'-prop-1-en-2-ylspiro[2-benzofuran-3,1'-cyclopropane]-1-one |
| PubChem CID | 134921823 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 2'-methyl-2'-prop-1-en-2-ylspiro[2-benzofuran-3,1'-cyclopropane]-1-one |
| SMILES | C=C(C)C1(C)CC12OC(=O)c1ccccc12 |
| InChI | InChI=1S/C14H14O2/c1-9(2)13(3)8-14(13)11-7-5-4-6-10(11)12(15)16-14/h4-7H,1,8H2,2-3H3 |
| InChIKey | XNRVCLYRRSILLX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2'-methyl-2'-prop-1-en-2-ylspiro[2-benzofuran-3,1'-cyclopropane]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2'-methyl-2'-prop-1-en-2-ylspiro[2-benzofuran-3,1'-cyclopropane]-1-one?
The IUPAC name of 2'-methyl-2'-prop-1-en-2-ylspiro[2-benzofuran-3,1'-cyclopropane]-1-one (CID 134921823) is 2'-methyl-2'-prop-1-en-2-ylspiro[2-benzofuran-3,1'-cyclopropane]-1-one.
What is the SMILES notation for 2'-methyl-2'-prop-1-en-2-ylspiro[2-benzofuran-3,1'-cyclopropane]-1-one?
The canonical SMILES for 2'-methyl-2'-prop-1-en-2-ylspiro[2-benzofuran-3,1'-cyclopropane]-1-one is C=C(C)C1(C)CC12OC(=O)c1ccccc12.
What is the InChIKey of 2'-methyl-2'-prop-1-en-2-ylspiro[2-benzofuran-3,1'-cyclopropane]-1-one?
The InChIKey is XNRVCLYRRSILLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O2/c1-9(2)13(3)8-14(13)11-7-5-4-6-10(11)12(15)16-14/h4-7H,1,8H2,2-3H3.
What are the key properties of 2'-methyl-2'-prop-1-en-2-ylspiro[2-benzofuran-3,1'-cyclopropane]-1-one?
2'-methyl-2'-prop-1-en-2-ylspiro[2-benzofuran-3,1'-cyclopropane]-1-one has a molecular weight of 214.26 g/mol, XLogP of 3.04, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2'-methyl-2'-prop-1-en-2-ylspiro[2-benzofuran-3,1'-cyclopropane]-1-one is sourced from PubChem (CID 134921823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).