About 1,1-dichloro-4,4-dimethoxybuta-1,2-diene
1,1-dichloro-4,4-dimethoxybuta-1,2-diene (PubChem CID 134921948) has the molecular formula C6H8Cl2O2
and a molecular weight of 183.03 g/mol. Its IUPAC name is 1,1-dichloro-4,4-dimethoxybuta-1,2-diene.
Molecular Properties
| Compound Name | 1,1-dichloro-4,4-dimethoxybuta-1,2-diene |
| PubChem CID | 134921948 |
| Molecular Formula | C6H8Cl2O2 |
| Molecular Weight | 183.03 g/mol |
| Exact Mass | 181.99 |
| IUPAC Name | 1,1-dichloro-4,4-dimethoxybuta-1,2-diene |
| SMILES | COC(C=C=C(Cl)Cl)OC |
| InChI | InChI=1S/C6H8Cl2O2/c1-9-6(10-2)4-3-5(7)8/h4,6H,1-2H3 |
| InChIKey | DAYUNRNWKRKJKK-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.03 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dichloro-4,4-dimethoxybuta-1,2-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dichloro-4,4-dimethoxybuta-1,2-diene?
The IUPAC name of 1,1-dichloro-4,4-dimethoxybuta-1,2-diene (CID 134921948) is 1,1-dichloro-4,4-dimethoxybuta-1,2-diene.
What is the SMILES notation for 1,1-dichloro-4,4-dimethoxybuta-1,2-diene?
The canonical SMILES for 1,1-dichloro-4,4-dimethoxybuta-1,2-diene is COC(C=C=C(Cl)Cl)OC.
What is the InChIKey of 1,1-dichloro-4,4-dimethoxybuta-1,2-diene?
The InChIKey is DAYUNRNWKRKJKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8Cl2O2/c1-9-6(10-2)4-3-5(7)8/h4,6H,1-2H3.
What are the key properties of 1,1-dichloro-4,4-dimethoxybuta-1,2-diene?
1,1-dichloro-4,4-dimethoxybuta-1,2-diene has a molecular weight of 183.03 g/mol, XLogP of 2.08, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dichloro-4,4-dimethoxybuta-1,2-diene is sourced from PubChem (CID 134921948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).