About N-[[(E)-2-chloro-1,2-difluoroethenyl]-(dimethylamino)phosphoryl]-N-methylmethanamine
N-[[(E)-2-chloro-1,2-difluoroethenyl]-(dimethylamino)phosphoryl]-N-methylmethanamine (PubChem CID 134922088) has the molecular formula C6H12ClF2N2OP
and a molecular weight of 232.60 g/mol. Its IUPAC name is N-[[(E)-2-chloro-1,2-difluoroethenyl]-(dimethylamino)phosphoryl]-N-methylmethanamine.
Molecular Properties
| Compound Name | N-[[(E)-2-chloro-1,2-difluoroethenyl]-(dimethylamino)phosphoryl]-N-methylmethanamine |
| PubChem CID | 134922088 |
| Molecular Formula | C6H12ClF2N2OP |
| Molecular Weight | 232.60 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | N-[[(E)-2-chloro-1,2-difluoroethenyl]-(dimethylamino)phosphoryl]-N-methylmethanamine |
| SMILES | CN(C)P(=O)(/C(F)=C(\F)Cl)N(C)C |
| InChI | InChI=1S/C6H12ClF2N2OP/c1-10(2)13(12,11(3)4)6(9)5(7)8/h1-4H3/b6-5- |
| InChIKey | HOINMQZJDUUERG-WAYWQWQTSA-N |
| XLogP | 2.61 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.60 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-[[(E)-2-chloro-1,2-difluoroethenyl]-(dimethylamino)phosphoryl]-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(E)-2-chloro-1,2-difluoroethenyl]-(dimethylamino)phosphoryl]-N-methylmethanamine?
The IUPAC name of N-[[(E)-2-chloro-1,2-difluoroethenyl]-(dimethylamino)phosphoryl]-N-methylmethanamine (CID 134922088) is N-[[(E)-2-chloro-1,2-difluoroethenyl]-(dimethylamino)phosphoryl]-N-methylmethanamine.
What is the SMILES notation for N-[[(E)-2-chloro-1,2-difluoroethenyl]-(dimethylamino)phosphoryl]-N-methylmethanamine?
The canonical SMILES for N-[[(E)-2-chloro-1,2-difluoroethenyl]-(dimethylamino)phosphoryl]-N-methylmethanamine is CN(C)P(=O)(/C(F)=C(\F)Cl)N(C)C.
What is the InChIKey of N-[[(E)-2-chloro-1,2-difluoroethenyl]-(dimethylamino)phosphoryl]-N-methylmethanamine?
The InChIKey is HOINMQZJDUUERG-WAYWQWQTSA-N. The full InChI is InChI=1S/C6H12ClF2N2OP/c1-10(2)13(12,11(3)4)6(9)5(7)8/h1-4H3/b6-5-.
What are the key properties of N-[[(E)-2-chloro-1,2-difluoroethenyl]-(dimethylamino)phosphoryl]-N-methylmethanamine?
N-[[(E)-2-chloro-1,2-difluoroethenyl]-(dimethylamino)phosphoryl]-N-methylmethanamine has a molecular weight of 232.60 g/mol, XLogP of 2.61, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(E)-2-chloro-1,2-difluoroethenyl]-(dimethylamino)phosphoryl]-N-methylmethanamine is sourced from PubChem (CID 134922088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).