About [(Z)-5,5-dimethyl-2-prop-2-enoxyhex-1-en-3-ynyl]-trimethylsilane
[(Z)-5,5-dimethyl-2-prop-2-enoxyhex-1-en-3-ynyl]-trimethylsilane (PubChem CID 134922129) has the molecular formula C14H24OSi
and a molecular weight of 236.43 g/mol. Its IUPAC name is [(Z)-5,5-dimethyl-2-prop-2-enoxyhex-1-en-3-ynyl]-trimethylsilane.
Molecular Properties
| Compound Name | [(Z)-5,5-dimethyl-2-prop-2-enoxyhex-1-en-3-ynyl]-trimethylsilane |
| PubChem CID | 134922129 |
| Molecular Formula | C14H24OSi |
| Molecular Weight | 236.43 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | [(Z)-5,5-dimethyl-2-prop-2-enoxyhex-1-en-3-ynyl]-trimethylsilane |
| SMILES | C=CCO/C(C#CC(C)(C)C)=C\[Si](C)(C)C |
| InChI | InChI=1S/C14H24OSi/c1-8-11-15-13(12-16(5,6)7)9-10-14(2,3)4/h8,12H,1,11H2,2-7H3/b13-12- |
| InChIKey | RPXYUDIZPDLXJY-SEYXRHQNSA-N |
| XLogP | 4.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-5,5-dimethyl-2-prop-2-enoxyhex-1-en-3-ynyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-5,5-dimethyl-2-prop-2-enoxyhex-1-en-3-ynyl]-trimethylsilane?
The IUPAC name of [(Z)-5,5-dimethyl-2-prop-2-enoxyhex-1-en-3-ynyl]-trimethylsilane (CID 134922129) is [(Z)-5,5-dimethyl-2-prop-2-enoxyhex-1-en-3-ynyl]-trimethylsilane.
What is the SMILES notation for [(Z)-5,5-dimethyl-2-prop-2-enoxyhex-1-en-3-ynyl]-trimethylsilane?
The canonical SMILES for [(Z)-5,5-dimethyl-2-prop-2-enoxyhex-1-en-3-ynyl]-trimethylsilane is C=CCO/C(C#CC(C)(C)C)=C\[Si](C)(C)C.
What is the InChIKey of [(Z)-5,5-dimethyl-2-prop-2-enoxyhex-1-en-3-ynyl]-trimethylsilane?
The InChIKey is RPXYUDIZPDLXJY-SEYXRHQNSA-N. The full InChI is InChI=1S/C14H24OSi/c1-8-11-15-13(12-16(5,6)7)9-10-14(2,3)4/h8,12H,1,11H2,2-7H3/b13-12-.
What are the key properties of [(Z)-5,5-dimethyl-2-prop-2-enoxyhex-1-en-3-ynyl]-trimethylsilane?
[(Z)-5,5-dimethyl-2-prop-2-enoxyhex-1-en-3-ynyl]-trimethylsilane has a molecular weight of 236.43 g/mol, XLogP of 4.00, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-5,5-dimethyl-2-prop-2-enoxyhex-1-en-3-ynyl]-trimethylsilane is sourced from PubChem (CID 134922129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).