C21H32F2O4Si — CID 134922153
dimethyl 7,7-difluoro-5-tri(propan-2-yl)silylbicyclo[4.2.0]octa-1(8),5-diene-3,3-dicarboxylate (PubChem CID 134922153) has the molecular formula C21H32F2O4Si and a molecular weight of 414.57 g/mol. Its IUPAC name is dimethyl 7,7-difluoro-5-tri(propan-2-yl)silylbicyclo[4.2.0]octa-1(8),5-diene-3,3-dicarboxylate.
| Compound Name | dimethyl 7,7-difluoro-5-tri(propan-2-yl)silylbicyclo[4.2.0]octa-1(8),5-diene-3,3-dicarboxylate |
|---|---|
| PubChem CID | 134922153 |
| Molecular Formula | C21H32F2O4Si |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | dimethyl 7,7-difluoro-5-tri(propan-2-yl)silylbicyclo[4.2.0]octa-1(8),5-diene-3,3-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC2=CC(F)(F)C2=C([Si](C(C)C)(C(C)C)C(C)C)C1 |
| InChI | InChI=1S/C21H32F2O4Si/c1-12(2)28(13(3)4,14(5)6)16-11-20(18(24)26-7,19(25)27-8)9-15-10-21(22,23)17(15)16/h10,12-14H,9,11H2,1-8H3 |
| InChIKey | ZONMSYISEFQHJY-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|