About [(1R)-1-phenylethyl] (2S)-3,3,3-trifluoro-2-phenylpropanoate
[(1R)-1-phenylethyl] (2S)-3,3,3-trifluoro-2-phenylpropanoate (PubChem CID 134922177) has the molecular formula C17H15F3O2
and a molecular weight of 308.30 g/mol. Its IUPAC name is [(1R)-1-phenylethyl] (2S)-3,3,3-trifluoro-2-phenylpropanoate.
Molecular Properties
| Compound Name | [(1R)-1-phenylethyl] (2S)-3,3,3-trifluoro-2-phenylpropanoate |
| PubChem CID | 134922177 |
| Molecular Formula | C17H15F3O2 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | [(1R)-1-phenylethyl] (2S)-3,3,3-trifluoro-2-phenylpropanoate |
| SMILES | C[C@@H](OC(=O)[C@H](c1ccccc1)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C17H15F3O2/c1-12(13-8-4-2-5-9-13)22-16(21)15(17(18,19)20)14-10-6-3-7-11-14/h2-12,15H,1H3/t12-,15+/m1/s1 |
| InChIKey | NKUARJZKZPLEIO-DOMZBBRYSA-N |
| XLogP | 4.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1R)-1-phenylethyl] (2S)-3,3,3-trifluoro-2-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-phenylethyl] (2S)-3,3,3-trifluoro-2-phenylpropanoate?
The IUPAC name of [(1R)-1-phenylethyl] (2S)-3,3,3-trifluoro-2-phenylpropanoate (CID 134922177) is [(1R)-1-phenylethyl] (2S)-3,3,3-trifluoro-2-phenylpropanoate.
What is the SMILES notation for [(1R)-1-phenylethyl] (2S)-3,3,3-trifluoro-2-phenylpropanoate?
The canonical SMILES for [(1R)-1-phenylethyl] (2S)-3,3,3-trifluoro-2-phenylpropanoate is C[C@@H](OC(=O)[C@H](c1ccccc1)C(F)(F)F)c1ccccc1.
What is the InChIKey of [(1R)-1-phenylethyl] (2S)-3,3,3-trifluoro-2-phenylpropanoate?
The InChIKey is NKUARJZKZPLEIO-DOMZBBRYSA-N. The full InChI is InChI=1S/C17H15F3O2/c1-12(13-8-4-2-5-9-13)22-16(21)15(17(18,19)20)14-10-6-3-7-11-14/h2-12,15H,1H3/t12-,15+/m1/s1.
What are the key properties of [(1R)-1-phenylethyl] (2S)-3,3,3-trifluoro-2-phenylpropanoate?
[(1R)-1-phenylethyl] (2S)-3,3,3-trifluoro-2-phenylpropanoate has a molecular weight of 308.30 g/mol, XLogP of 4.64, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-phenylethyl] (2S)-3,3,3-trifluoro-2-phenylpropanoate is sourced from PubChem (CID 134922177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).