C20H20O3 — CID 134922179
3,4-dimethyl-3,4-bis(4-methylphenyl)oxolane-2,5-dione (PubChem CID 134922179) has the molecular formula C20H20O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is 3,4-dimethyl-3,4-bis(4-methylphenyl)oxolane-2,5-dione.
| Compound Name | 3,4-dimethyl-3,4-bis(4-methylphenyl)oxolane-2,5-dione |
|---|---|
| PubChem CID | 134922179 |
| Molecular Formula | C20H20O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 3,4-dimethyl-3,4-bis(4-methylphenyl)oxolane-2,5-dione |
| SMILES | Cc1ccc(C2(C)C(=O)OC(=O)C2(C)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H20O3/c1-13-5-9-15(10-6-13)19(3)17(21)23-18(22)20(19,4)16-11-7-14(2)8-12-16/h5-12H,1-4H3 |
| InChIKey | BFYYLOSHOSDQSM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|