C8H4BrCl2N7O2 — CID 134922227
1-[(3E)-4-bromo-3,4-dichloro-2-nitro-1-(1,2,4-triazol-1-yl)buta-1,3-dienyl]-1,2,4-triazole (PubChem CID 134922227) has the molecular formula C8H4BrCl2N7O2 and a molecular weight of 380.98 g/mol. Its IUPAC name is 1-[(3E)-4-bromo-3,4-dichloro-2-nitro-1-(1,2,4-triazol-1-yl)buta-1,3-dienyl]-1,2,4-triazole.
| Compound Name | 1-[(3E)-4-bromo-3,4-dichloro-2-nitro-1-(1,2,4-triazol-1-yl)buta-1,3-dienyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 134922227 |
| Molecular Formula | C8H4BrCl2N7O2 |
| Molecular Weight | 380.98 g/mol |
| Exact Mass | 378.90 |
| IUPAC Name | 1-[(3E)-4-bromo-3,4-dichloro-2-nitro-1-(1,2,4-triazol-1-yl)buta-1,3-dienyl]-1,2,4-triazole |
| SMILES | O=[N+]([O-])C(=C(n1cncn1)n1cncn1)/C(Cl)=C(/Cl)Br |
| InChI | InChI=1S/C8H4BrCl2N7O2/c9-7(11)5(10)6(18(19)20)8(16-3-12-1-14-16)17-4-13-2-15-17/h1-4H/b7-5- |
| InChIKey | XZYKZPCTECEFPA-ALCCZGGFSA-N |
| XLogP | 1.68 |
| TPSA | 104.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.98 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|