C13H5F8NO2 — CID 134922293
6-(1,1,2,2,2-pentafluoroethyl)-2-phenyl-5-(trifluoromethyl)-1,3-oxazin-4-one (PubChem CID 134922293) has the molecular formula C13H5F8NO2 and a molecular weight of 359.17 g/mol. Its IUPAC name is 6-(1,1,2,2,2-pentafluoroethyl)-2-phenyl-5-(trifluoromethyl)-1,3-oxazin-4-one.
| Compound Name | 6-(1,1,2,2,2-pentafluoroethyl)-2-phenyl-5-(trifluoromethyl)-1,3-oxazin-4-one |
|---|---|
| PubChem CID | 134922293 |
| Molecular Formula | C13H5F8NO2 |
| Molecular Weight | 359.17 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | 6-(1,1,2,2,2-pentafluoroethyl)-2-phenyl-5-(trifluoromethyl)-1,3-oxazin-4-one |
| SMILES | O=c1nc(-c2ccccc2)oc(C(F)(F)C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C13H5F8NO2/c14-11(15,13(19,20)21)8-7(12(16,17)18)9(23)22-10(24-8)6-4-2-1-3-5-6/h1-5H |
| InChIKey | NDRNXUYLJVVARU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.17 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|