C19H30O5 — CID 134922362
ditert-butyl (1S,2S,3E)-8-oxocyclonon-3-ene-1,2-dicarboxylate (PubChem CID 134922362) has the molecular formula C19H30O5 and a molecular weight of 338.44 g/mol. Its IUPAC name is ditert-butyl (1S,2S,3E)-8-oxocyclonon-3-ene-1,2-dicarboxylate.
| Compound Name | ditert-butyl (1S,2S,3E)-8-oxocyclonon-3-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 134922362 |
| Molecular Formula | C19H30O5 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | ditert-butyl (1S,2S,3E)-8-oxocyclonon-3-ene-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1/C=C/CCCC(=O)C[C@@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H30O5/c1-18(2,3)23-16(21)14-11-9-7-8-10-13(20)12-15(14)17(22)24-19(4,5)6/h9,11,14-15H,7-8,10,12H2,1-6H3/b11-9+/t14-,15-/m0/s1 |
| InChIKey | VEEATIVOSSSTTQ-WWUQSUGHSA-N |
| XLogP | 3.60 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|