C18H20O6 — CID 134922432
diethyl (1R,2S,3S,4R,7S,8R,9R,10S)-5,12-dioxopentacyclo[6.4.0.02,10.03,7.04,9]dodecane-8,9-dicarboxylate (PubChem CID 134922432) has the molecular formula C18H20O6 and a molecular weight of 332.35 g/mol. Its IUPAC name is diethyl (1R,2S,3S,4R,7S,8R,9R,10S)-5,12-dioxopentacyclo[6.4.0.02,10.03,7.04,9]dodecane-8,9-dicarboxylate.
| Compound Name | diethyl (1R,2S,3S,4R,7S,8R,9R,10S)-5,12-dioxopentacyclo[6.4.0.02,10.03,7.04,9]dodecane-8,9-dicarboxylate |
|---|---|
| PubChem CID | 134922432 |
| Molecular Formula | C18H20O6 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | diethyl (1R,2S,3S,4R,7S,8R,9R,10S)-5,12-dioxopentacyclo[6.4.0.02,10.03,7.04,9]dodecane-8,9-dicarboxylate |
| SMILES | CCOC(=O)[C@@]12[C@@H]3C(=O)C[C@H]4[C@@H]3[C@@H]3[C@@H](C(=O)C[C@@H]31)[C@]42C(=O)OCC |
| InChI | InChI=1S/C18H20O6/c1-3-23-15(21)17-7-5-10(20)14-11(7)12-8(6-9(19)13(12)17)18(14,17)16(22)24-4-2/h7-8,11-14H,3-6H2,1-2H3/t7-,8-,11+,12+,13+,14+,17-,18-/m0/s1 |
| InChIKey | WTOCBMGBVZRTNM-XFYVIKRMSA-N |
| XLogP | 0.77 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |