C15H24O4 — CID 134922479
(3'R,4'aR,8'aR)-4'a-(methoxymethyl)-3'-methylspiro[1,3-dioxolane-2,7'-3,4,5,6,8,8a-hexahydro-1H-naphthalene]-2'-one (PubChem CID 134922479) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (3'R,4'aR,8'aR)-4'a-(methoxymethyl)-3'-methylspiro[1,3-dioxolane-2,7'-3,4,5,6,8,8a-hexahydro-1H-naphthalene]-2'-one.
| Compound Name | (3'R,4'aR,8'aR)-4'a-(methoxymethyl)-3'-methylspiro[1,3-dioxolane-2,7'-3,4,5,6,8,8a-hexahydro-1H-naphthalene]-2'-one |
|---|---|
| PubChem CID | 134922479 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (3'R,4'aR,8'aR)-4'a-(methoxymethyl)-3'-methylspiro[1,3-dioxolane-2,7'-3,4,5,6,8,8a-hexahydro-1H-naphthalene]-2'-one |
| SMILES | COC[C@@]12CCC3(C[C@H]1CC(=O)[C@H](C)C2)OCCO3 |
| InChI | InChI=1S/C15H24O4/c1-11-8-14(10-17-2)3-4-15(18-5-6-19-15)9-12(14)7-13(11)16/h11-12H,3-10H2,1-2H3/t11-,12-,14+/m1/s1 |
| InChIKey | GLCUEUCEMONUCM-BZPMIXESSA-N |
| XLogP | 2.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |