C15H22O3 — CID 134922535
methyl (3aR,7aS)-1-methyl-6-oxo-7a-propan-2-yl-3,4,5,7-tetrahydroindene-3a-carboxylate (PubChem CID 134922535) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is methyl (3aR,7aS)-1-methyl-6-oxo-7a-propan-2-yl-3,4,5,7-tetrahydroindene-3a-carboxylate.
| Compound Name | methyl (3aR,7aS)-1-methyl-6-oxo-7a-propan-2-yl-3,4,5,7-tetrahydroindene-3a-carboxylate |
|---|---|
| PubChem CID | 134922535 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | methyl (3aR,7aS)-1-methyl-6-oxo-7a-propan-2-yl-3,4,5,7-tetrahydroindene-3a-carboxylate |
| SMILES | COC(=O)[C@]12CC=C(C)[C@@]1(C(C)C)CC(=O)CC2 |
| InChI | InChI=1S/C15H22O3/c1-10(2)15-9-12(16)6-8-14(15,13(17)18-4)7-5-11(15)3/h5,10H,6-9H2,1-4H3/t14-,15+/m1/s1 |
| InChIKey | VIGMYZKCUWEXFW-CABCVRRESA-N |
| XLogP | 2.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|