C17H22O4 — CID 134922571
4'b-methylspiro[1,3-dioxolane-2,7'-2,3,4a,5,6,8,10,10a-octahydrophenanthrene]-1',4'-dione (PubChem CID 134922571) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is 4'b-methylspiro[1,3-dioxolane-2,7'-2,3,4a,5,6,8,10,10a-octahydrophenanthrene]-1',4'-dione.
| Compound Name | 4'b-methylspiro[1,3-dioxolane-2,7'-2,3,4a,5,6,8,10,10a-octahydrophenanthrene]-1',4'-dione |
|---|---|
| PubChem CID | 134922571 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 4'b-methylspiro[1,3-dioxolane-2,7'-2,3,4a,5,6,8,10,10a-octahydrophenanthrene]-1',4'-dione |
| SMILES | CC12CCC3(CC1=CCC1C(=O)CCC(=O)C12)OCCO3 |
| InChI | InChI=1S/C17H22O4/c1-16-6-7-17(20-8-9-21-17)10-11(16)2-3-12-13(18)4-5-14(19)15(12)16/h2,12,15H,3-10H2,1H3 |
| InChIKey | VFMHHKPNLKLJLU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|